About [ethoxy(methylidene)silyl] acetate;formaldehyde;methane
[ethoxy(methylidene)silyl] acetate;formaldehyde;methane (PubChem CID 158075347) has the molecular formula C7H16O4Si
and a molecular weight of 192.29 g/mol. Its IUPAC name is [ethoxy(methylidene)silyl] acetate;formaldehyde;methane.
Molecular Properties
| Compound Name | [ethoxy(methylidene)silyl] acetate;formaldehyde;methane |
| PubChem CID | 158075347 |
| Molecular Formula | C7H16O4Si |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | [ethoxy(methylidene)silyl] acetate;formaldehyde;methane |
| SMILES | C.C=O.C=[Si](OCC)OC(C)=O |
| InChI | InChI=1S/C5H10O3Si.CH2O.CH4/c1-4-7-9(3)8-5(2)6;1-2;/h3-4H2,1-2H3;1H2;1H4 |
| InChIKey | FMHLOAZRGKSCJO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [ethoxy(methylidene)silyl] acetate;formaldehyde;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethoxy(methylidene)silyl] acetate;formaldehyde;methane?
The IUPAC name of [ethoxy(methylidene)silyl] acetate;formaldehyde;methane (CID 158075347) is [ethoxy(methylidene)silyl] acetate;formaldehyde;methane.
What is the SMILES notation for [ethoxy(methylidene)silyl] acetate;formaldehyde;methane?
The canonical SMILES for [ethoxy(methylidene)silyl] acetate;formaldehyde;methane is C.C=O.C=[Si](OCC)OC(C)=O.
What is the InChIKey of [ethoxy(methylidene)silyl] acetate;formaldehyde;methane?
The InChIKey is FMHLOAZRGKSCJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3Si.CH2O.CH4/c1-4-7-9(3)8-5(2)6;1-2;/h3-4H2,1-2H3;1H2;1H4.
What are the key properties of [ethoxy(methylidene)silyl] acetate;formaldehyde;methane?
[ethoxy(methylidene)silyl] acetate;formaldehyde;methane has a molecular weight of 192.29 g/mol, XLogP of 0.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [ethoxy(methylidene)silyl] acetate;formaldehyde;methane is sourced from PubChem (CID 158075347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).