About [methoxy(oxo)silyl] acetate
[methoxy(oxo)silyl] acetate (PubChem CID 56988795) has the molecular formula C3H6O4Si
and a molecular weight of 134.16 g/mol. Its IUPAC name is [methoxy(oxo)silyl] acetate.
Molecular Properties
| Compound Name | [methoxy(oxo)silyl] acetate |
| PubChem CID | 56988795 |
| Molecular Formula | C3H6O4Si |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.00 |
| IUPAC Name | [methoxy(oxo)silyl] acetate |
| SMILES | CO[Si](=O)OC(C)=O |
| InChI | InChI=1S/C3H6O4Si/c1-3(4)7-8(5)6-2/h1-2H3 |
| InChIKey | SUSSUXHCHHBSSR-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [methoxy(oxo)silyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methoxy(oxo)silyl] acetate?
The IUPAC name of [methoxy(oxo)silyl] acetate (CID 56988795) is [methoxy(oxo)silyl] acetate.
What is the SMILES notation for [methoxy(oxo)silyl] acetate?
The canonical SMILES for [methoxy(oxo)silyl] acetate is CO[Si](=O)OC(C)=O.
What is the InChIKey of [methoxy(oxo)silyl] acetate?
The InChIKey is SUSSUXHCHHBSSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O4Si/c1-3(4)7-8(5)6-2/h1-2H3.
What are the key properties of [methoxy(oxo)silyl] acetate?
[methoxy(oxo)silyl] acetate has a molecular weight of 134.16 g/mol, XLogP of -0.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [methoxy(oxo)silyl] acetate is sourced from PubChem (CID 56988795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).