About CID 136913426
CID 136913426 (PubChem CID 136913426) has the molecular formula C8H17O3Si
and a molecular weight of 189.31 g/mol.
Molecular Properties
| Compound Name | CID 136913426 |
| PubChem CID | 136913426 |
| Molecular Formula | C8H17O3Si |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | — |
| SMILES | CCO[Si](OC(C)=O)C(C)CC |
| InChI | InChI=1S/C8H17O3Si/c1-5-7(3)12(10-6-2)11-8(4)9/h7H,5-6H2,1-4H3 |
| InChIKey | NOEXVYIAHDVTAF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136913426 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136913426?
The IUPAC name of CID 136913426 (CID 136913426) is not available.
What is the SMILES notation for CID 136913426?
The canonical SMILES for CID 136913426 is CCO[Si](OC(C)=O)C(C)CC.
What is the InChIKey of CID 136913426?
The InChIKey is NOEXVYIAHDVTAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O3Si/c1-5-7(3)12(10-6-2)11-8(4)9/h7H,5-6H2,1-4H3.
What are the key properties of CID 136913426?
CID 136913426 has a molecular weight of 189.31 g/mol, XLogP of 1.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136913426 is sourced from PubChem (CID 136913426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).