C8H18O2SSi — CID 163262157
2,2-diethoxythiasilinane (PubChem CID 163262157) has the molecular formula C8H18O2SSi and a molecular weight of 206.38 g/mol. Its IUPAC name is 2,2-diethoxythiasilinane.
| Compound Name | 2,2-diethoxythiasilinane |
|---|---|
| PubChem CID | 163262157 |
| Molecular Formula | C8H18O2SSi |
| Molecular Weight | 206.38 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2,2-diethoxythiasilinane |
| SMILES | CCO[Si]1(OCC)CCCCS1 |
| InChI | InChI=1S/C8H18O2SSi/c1-3-9-12(10-4-2)8-6-5-7-11-12/h3-8H2,1-2H3 |
| InChIKey | QUVQAGOOPPNDHU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|