C13H30O3Si — CID 174650562
ethane;1,1,2-triethoxysilinane (PubChem CID 174650562) has the molecular formula C13H30O3Si and a molecular weight of 262.47 g/mol. Its IUPAC name is ethane;1,1,2-triethoxysilinane.
| Compound Name | ethane;1,1,2-triethoxysilinane |
|---|---|
| PubChem CID | 174650562 |
| Molecular Formula | C13H30O3Si |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | ethane;1,1,2-triethoxysilinane |
| SMILES | CC.CCOC1CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C11H24O3Si.C2H6/c1-4-12-11-9-7-8-10-15(11,13-5-2)14-6-3;1-2/h11H,4-10H2,1-3H3;1-2H3 |
| InChIKey | PNJPHENPZIZHEK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|