About 3,3-diethoxyoxadisilinane
3,3-diethoxyoxadisilinane (PubChem CID 173106077) has the molecular formula C7H18O3Si2
and a molecular weight of 206.39 g/mol. Its IUPAC name is 3,3-diethoxyoxadisilinane.
Molecular Properties
| Compound Name | 3,3-diethoxyoxadisilinane |
| PubChem CID | 173106077 |
| Molecular Formula | C7H18O3Si2 |
| Molecular Weight | 206.39 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3,3-diethoxyoxadisilinane |
| SMILES | CCO[Si]1(OCC)CCCO[SiH2]1 |
| InChI | InChI=1S/C7H18O3Si2/c1-3-9-12(10-4-2)7-5-6-8-11-12/h3-7,11H2,1-2H3 |
| InChIKey | TWXJOBLKFRSBFH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxyoxadisilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxyoxadisilinane?
The IUPAC name of 3,3-diethoxyoxadisilinane (CID 173106077) is 3,3-diethoxyoxadisilinane.
What is the SMILES notation for 3,3-diethoxyoxadisilinane?
The canonical SMILES for 3,3-diethoxyoxadisilinane is CCO[Si]1(OCC)CCCO[SiH2]1.
What is the InChIKey of 3,3-diethoxyoxadisilinane?
The InChIKey is TWXJOBLKFRSBFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O3Si2/c1-3-9-12(10-4-2)7-5-6-8-11-12/h3-7,11H2,1-2H3.
What are the key properties of 3,3-diethoxyoxadisilinane?
3,3-diethoxyoxadisilinane has a molecular weight of 206.39 g/mol, XLogP of 0.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxyoxadisilinane is sourced from PubChem (CID 173106077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).