C8H20O8Si2 — CID 11066533
3,3,6,6-tetraethoxy-1,2,4,5,3,6-tetraoxadisilinane (PubChem CID 11066533) has the molecular formula C8H20O8Si2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 3,3,6,6-tetraethoxy-1,2,4,5,3,6-tetraoxadisilinane.
| Compound Name | 3,3,6,6-tetraethoxy-1,2,4,5,3,6-tetraoxadisilinane |
|---|---|
| PubChem CID | 11066533 |
| Molecular Formula | C8H20O8Si2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3,3,6,6-tetraethoxy-1,2,4,5,3,6-tetraoxadisilinane |
| SMILES | CCO[Si]1(OCC)OO[Si](OCC)(OCC)OO1 |
| InChI | InChI=1S/C8H20O8Si2/c1-5-9-17(10-6-2)13-15-18(11-7-3,12-8-4)16-14-17/h5-8H2,1-4H3 |
| InChIKey | SLUXTMQMUCARHD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|