C12H40O12Si8 — CID 123246826
methyl-[[2,4,6,8-tetraethoxy-4,6,8-tris(methylsilyloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]silane (PubChem CID 123246826) has the molecular formula C12H40O12Si8 and a molecular weight of 601.13 g/mol. Its IUPAC name is methyl-[[2,4,6,8-tetraethoxy-4,6,8-tris(methylsilyloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]silane.
| Compound Name | methyl-[[2,4,6,8-tetraethoxy-4,6,8-tris(methylsilyloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]silane |
|---|---|
| PubChem CID | 123246826 |
| Molecular Formula | C12H40O12Si8 |
| Molecular Weight | 601.13 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | methyl-[[2,4,6,8-tetraethoxy-4,6,8-tris(methylsilyloxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy]silane |
| SMILES | CCO[Si]1(O[SiH2]C)O[Si](OCC)(O[SiH2]C)O[Si](OCC)(O[SiH2]C)O[Si](OCC)(O[SiH2]C)O1 |
| InChI | InChI=1S/C12H40O12Si8/c1-9-13-29(17-25-5)21-30(14-10-2,18-26-6)23-32(16-12-4,20-28-8)24-31(22-29,15-11-3)19-27-7/h9-12,25-28H2,1-8H3 |
| InChIKey | AJOOOWPFUYTDPY-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.13 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|