C7H16OSi — CID 139716873
2,2-diethyloxasilolane (PubChem CID 139716873) has the molecular formula C7H16OSi and a molecular weight of 144.29 g/mol. Its IUPAC name is 2,2-diethyloxasilolane.
| Compound Name | 2,2-diethyloxasilolane |
|---|---|
| PubChem CID | 139716873 |
| Molecular Formula | C7H16OSi |
| Molecular Weight | 144.29 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 2,2-diethyloxasilolane |
| SMILES | CC[Si]1(CC)CCCO1 |
| InChI | InChI=1S/C7H16OSi/c1-3-9(4-2)7-5-6-8-9/h3-7H2,1-2H3 |
| InChIKey | OMOOFLIYGMUQCC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|