C20H34O3Si — CID 87523075
2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane (PubChem CID 87523075) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane.
| Compound Name | 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane |
|---|---|
| PubChem CID | 87523075 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane |
| SMILES | CC[Si]1(CC)CCCC(C2CCC3OC3C2)(C2CCC3OC3C2)O1 |
| InChI | InChI=1S/C20H34O3Si/c1-3-24(4-2)11-5-10-20(23-24,14-6-8-16-18(12-14)21-16)15-7-9-17-19(13-15)22-17/h14-19H,3-13H2,1-2H3 |
| InChIKey | CJGPKHGYJXNJJM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|