About 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane
2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane (PubChem CID 87523075) has the molecular formula C20H34O3Si
and a molecular weight of 350.58 g/mol. Its IUPAC name is 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane.
Molecular Properties
| Compound Name | 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane |
| PubChem CID | 87523075 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane |
| SMILES | CC[Si]1(CC)CCCC(C2CCC3OC3C2)(C2CCC3OC3C2)O1 |
| InChI | InChI=1S/C20H34O3Si/c1-3-24(4-2)11-5-10-20(23-24,14-6-8-16-18(12-14)21-16)15-7-9-17-19(13-15)22-17/h14-19H,3-13H2,1-2H3 |
| InChIKey | CJGPKHGYJXNJJM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane?
The IUPAC name of 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane (CID 87523075) is 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane.
What is the SMILES notation for 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane?
The canonical SMILES for 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane is CC[Si]1(CC)CCCC(C2CCC3OC3C2)(C2CCC3OC3C2)O1.
What is the InChIKey of 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane?
The InChIKey is CJGPKHGYJXNJJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O3Si/c1-3-24(4-2)11-5-10-20(23-24,14-6-8-16-18(12-14)21-16)15-7-9-17-19(13-15)22-17/h14-19H,3-13H2,1-2H3.
What are the key properties of 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane?
2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane has a molecular weight of 350.58 g/mol, XLogP of 4.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-6,6-bis(7-oxabicyclo[4.1.0]heptan-3-yl)oxasilinane is sourced from PubChem (CID 87523075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).