C11H26O2Si2 — CID 19097651
2,2-dimethyloxasilolane;2,2,3-trimethyloxasilolane (PubChem CID 19097651) has the molecular formula C11H26O2Si2 and a molecular weight of 246.50 g/mol. Its IUPAC name is 2,2-dimethyloxasilolane;2,2,3-trimethyloxasilolane.
| Compound Name | 2,2-dimethyloxasilolane;2,2,3-trimethyloxasilolane |
|---|---|
| PubChem CID | 19097651 |
| Molecular Formula | C11H26O2Si2 |
| Molecular Weight | 246.50 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2,2-dimethyloxasilolane;2,2,3-trimethyloxasilolane |
| SMILES | CC1CCO[Si]1(C)C.C[Si]1(C)CCCO1 |
| InChI | InChI=1S/C6H14OSi.C5H12OSi/c1-6-4-5-7-8(6,2)3;1-7(2)5-3-4-6-7/h6H,4-5H2,1-3H3;3-5H2,1-2H3 |
| InChIKey | SXSLWLZWNSNKPQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|