C8H22OSi3 — CID 608922
2,2,4,4,6,6-hexamethyl-1,2,4,6-oxatrisilinane (PubChem CID 608922) has the molecular formula C8H22OSi3 and a molecular weight of 218.52 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexamethyl-1,2,4,6-oxatrisilinane.
| Compound Name | 2,2,4,4,6,6-hexamethyl-1,2,4,6-oxatrisilinane |
|---|---|
| PubChem CID | 608922 |
| Molecular Formula | C8H22OSi3 |
| Molecular Weight | 218.52 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 2,2,4,4,6,6-hexamethyl-1,2,4,6-oxatrisilinane |
| SMILES | C[Si]1(C)C[Si](C)(C)O[Si](C)(C)C1 |
| InChI | InChI=1S/C8H22OSi3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h7-8H2,1-6H3 |
| InChIKey | MKWLKZYAJJJDDT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|