C3H8O2Si — CID 141498516
3,3-dimethyldioxasiletane (PubChem CID 141498516) has the molecular formula C3H8O2Si and a molecular weight of 104.18 g/mol. Its IUPAC name is 3,3-dimethyldioxasiletane.
| Compound Name | 3,3-dimethyldioxasiletane |
|---|---|
| PubChem CID | 141498516 |
| Molecular Formula | C3H8O2Si |
| Molecular Weight | 104.18 g/mol |
| Exact Mass | 104.03 |
| IUPAC Name | 3,3-dimethyldioxasiletane |
| SMILES | C[Si]1(C)COO1 |
| InChI | InChI=1S/C3H8O2Si/c1-6(2)3-4-5-6/h3H2,1-2H3 |
| InChIKey | MXTKDZCGONEDSV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|