C6H16O4Si2 — CID 71209359
2,5-dimethoxy-2,5-dimethyl-1,4,2,5-dioxadisilinane (PubChem CID 71209359) has the molecular formula C6H16O4Si2 and a molecular weight of 208.36 g/mol. Its IUPAC name is 2,5-dimethoxy-2,5-dimethyl-1,4,2,5-dioxadisilinane.
| Compound Name | 2,5-dimethoxy-2,5-dimethyl-1,4,2,5-dioxadisilinane |
|---|---|
| PubChem CID | 71209359 |
| Molecular Formula | C6H16O4Si2 |
| Molecular Weight | 208.36 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 2,5-dimethoxy-2,5-dimethyl-1,4,2,5-dioxadisilinane |
| SMILES | CO[Si]1(C)CO[Si](C)(OC)CO1 |
| InChI | InChI=1S/C6H16O4Si2/c1-7-11(3)5-10-12(4,8-2)6-9-11/h5-6H2,1-4H3 |
| InChIKey | BKDJIJJKEXYRJR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|