C13H27NO3Si — CID 67462069
1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine (PubChem CID 67462069) has the molecular formula C13H27NO3Si and a molecular weight of 273.45 g/mol. Its IUPAC name is 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine.
| Compound Name | 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine |
|---|---|
| PubChem CID | 67462069 |
| Molecular Formula | C13H27NO3Si |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine |
| SMILES | CO[Si]1(C)CCCOCC(CN2CCCCC2)O1 |
| InChI | InChI=1S/C13H27NO3Si/c1-15-18(2)10-6-9-16-12-13(17-18)11-14-7-4-3-5-8-14/h13H,3-12H2,1-2H3 |
| InChIKey | FNNWXRVXBVKLFP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|