About 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine
1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine (PubChem CID 67462069) has the molecular formula C13H27NO3Si
and a molecular weight of 273.45 g/mol. Its IUPAC name is 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine.
Molecular Properties
| Compound Name | 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine |
| PubChem CID | 67462069 |
| Molecular Formula | C13H27NO3Si |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine |
| SMILES | CO[Si]1(C)CCCOCC(CN2CCCCC2)O1 |
| InChI | InChI=1S/C13H27NO3Si/c1-15-18(2)10-6-9-16-12-13(17-18)11-14-7-4-3-5-8-14/h13H,3-12H2,1-2H3 |
| InChIKey | FNNWXRVXBVKLFP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine?
The IUPAC name of 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine (CID 67462069) is 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine.
What is the SMILES notation for 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine?
The canonical SMILES for 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine is CO[Si]1(C)CCCOCC(CN2CCCCC2)O1.
What is the InChIKey of 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine?
The InChIKey is FNNWXRVXBVKLFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO3Si/c1-15-18(2)10-6-9-16-12-13(17-18)11-14-7-4-3-5-8-14/h13H,3-12H2,1-2H3.
What are the key properties of 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine?
1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine has a molecular weight of 273.45 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methoxy-2-methyl-1,6,2-dioxasilocan-8-yl)methyl]piperidine is sourced from PubChem (CID 67462069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).