C13H27NO4Si — CID 150485048
6-ethyl-1-methoxy-3-methyl-2,10,14-trioxa-6-aza-1-silabicyclo[6.5.1]tetradecane (PubChem CID 150485048) has the molecular formula C13H27NO4Si and a molecular weight of 289.45 g/mol. Its IUPAC name is 6-ethyl-1-methoxy-3-methyl-2,10,14-trioxa-6-aza-1-silabicyclo[6.5.1]tetradecane.
| Compound Name | 6-ethyl-1-methoxy-3-methyl-2,10,14-trioxa-6-aza-1-silabicyclo[6.5.1]tetradecane |
|---|---|
| PubChem CID | 150485048 |
| Molecular Formula | C13H27NO4Si |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 6-ethyl-1-methoxy-3-methyl-2,10,14-trioxa-6-aza-1-silabicyclo[6.5.1]tetradecane |
| SMILES | CCN1CCC(C)O[Si]2(OC)CCCOCC(C1)O2 |
| InChI | InChI=1S/C13H27NO4Si/c1-4-14-7-6-12(2)17-19(15-3)9-5-8-16-11-13(10-14)18-19/h12-13H,4-11H2,1-3H3 |
| InChIKey | HUPUMDWPQNDAKG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|