C11H23NO4Si — CID 150977084
1-methoxy-6-methyl-2,10,14-trioxa-6-aza-1-silabicyclo[6.5.1]tetradecane (PubChem CID 150977084) has the molecular formula C11H23NO4Si and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-methoxy-6-methyl-2,10,14-trioxa-6-aza-1-silabicyclo[6.5.1]tetradecane.
| Compound Name | 1-methoxy-6-methyl-2,10,14-trioxa-6-aza-1-silabicyclo[6.5.1]tetradecane |
|---|---|
| PubChem CID | 150977084 |
| Molecular Formula | C11H23NO4Si |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-methoxy-6-methyl-2,10,14-trioxa-6-aza-1-silabicyclo[6.5.1]tetradecane |
| SMILES | CO[Si]12CCCOCC(CN(C)CCCO1)O2 |
| InChI | InChI=1S/C11H23NO4Si/c1-12-5-3-7-15-17(13-2)8-4-6-14-10-11(9-12)16-17/h11H,3-10H2,1-2H3 |
| InChIKey | LPHXGTGDWJDMLF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|