C9H18INO2 — CID 148911348
1-[(1-methyl-1λ3,2,5-iodadioxolan-3-yl)methyl]piperidine (PubChem CID 148911348) has the molecular formula C9H18INO2 and a molecular weight of 299.15 g/mol. Its IUPAC name is 1-[(1-methyl-1λ3,2,5-iodadioxolan-3-yl)methyl]piperidine.
| Compound Name | 1-[(1-methyl-1λ3,2,5-iodadioxolan-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 148911348 |
| Molecular Formula | C9H18INO2 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-[(1-methyl-1λ3,2,5-iodadioxolan-3-yl)methyl]piperidine |
| SMILES | CI1OCC(CN2CCCCC2)O1 |
| InChI | InChI=1S/C9H18INO2/c1-10-12-8-9(13-10)7-11-5-3-2-4-6-11/h9H,2-8H2,1H3 |
| InChIKey | PIRRNTPUNPPWRF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|