About 2,2-dimethoxyoxasiletane
2,2-dimethoxyoxasiletane (PubChem CID 11137216) has the molecular formula C4H10O3Si
and a molecular weight of 134.21 g/mol. Its IUPAC name is 2,2-dimethoxyoxasiletane.
Molecular Properties
| Compound Name | 2,2-dimethoxyoxasiletane |
| PubChem CID | 11137216 |
| Molecular Formula | C4H10O3Si |
| Molecular Weight | 134.21 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 2,2-dimethoxyoxasiletane |
| SMILES | CO[Si]1(OC)CCO1 |
| InChI | InChI=1S/C4H10O3Si/c1-5-8(6-2)4-3-7-8/h3-4H2,1-2H3 |
| InChIKey | WMMYYUPYPBXHBQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxyoxasiletane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxyoxasiletane?
The IUPAC name of 2,2-dimethoxyoxasiletane (CID 11137216) is 2,2-dimethoxyoxasiletane.
What is the SMILES notation for 2,2-dimethoxyoxasiletane?
The canonical SMILES for 2,2-dimethoxyoxasiletane is CO[Si]1(OC)CCO1.
What is the InChIKey of 2,2-dimethoxyoxasiletane?
The InChIKey is WMMYYUPYPBXHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3Si/c1-5-8(6-2)4-3-7-8/h3-4H2,1-2H3.
What are the key properties of 2,2-dimethoxyoxasiletane?
2,2-dimethoxyoxasiletane has a molecular weight of 134.21 g/mol, XLogP of 0.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyoxasiletane is sourced from PubChem (CID 11137216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).