C4H10O3Si — CID 11137216
2,2-dimethoxyoxasiletane (PubChem CID 11137216) has the molecular formula C4H10O3Si and a molecular weight of 134.21 g/mol. Its IUPAC name is 2,2-dimethoxyoxasiletane.
| Compound Name | 2,2-dimethoxyoxasiletane |
|---|---|
| PubChem CID | 11137216 |
| Molecular Formula | C4H10O3Si |
| Molecular Weight | 134.21 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 2,2-dimethoxyoxasiletane |
| SMILES | CO[Si]1(OC)CCO1 |
| InChI | InChI=1S/C4H10O3Si/c1-5-8(6-2)4-3-7-8/h3-4H2,1-2H3 |
| InChIKey | WMMYYUPYPBXHBQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|