C12H28O3SSi2 — CID 151704694
2,2-dimethoxy-7,7,8,8-tetramethyl-1,6,2,7-oxathiadisilecane (PubChem CID 151704694) has the molecular formula C12H28O3SSi2 and a molecular weight of 308.59 g/mol. Its IUPAC name is 2,2-dimethoxy-7,7,8,8-tetramethyl-1,6,2,7-oxathiadisilecane.
| Compound Name | 2,2-dimethoxy-7,7,8,8-tetramethyl-1,6,2,7-oxathiadisilecane |
|---|---|
| PubChem CID | 151704694 |
| Molecular Formula | C12H28O3SSi2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2,2-dimethoxy-7,7,8,8-tetramethyl-1,6,2,7-oxathiadisilecane |
| SMILES | CO[Si]1(OC)CCCS[Si](C)(C)C(C)(C)CCO1 |
| InChI | InChI=1S/C12H28O3SSi2/c1-12(2)8-9-15-18(13-3,14-4)11-7-10-16-17(12,5)6/h7-11H2,1-6H3 |
| InChIKey | RFIKQIGMILYFPA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|