C6H15NO3Si — CID 174466968
2,2-dimethoxyoxasilinan-6-amine (PubChem CID 174466968) has the molecular formula C6H15NO3Si and a molecular weight of 177.28 g/mol. Its IUPAC name is 2,2-dimethoxyoxasilinan-6-amine.
| Compound Name | 2,2-dimethoxyoxasilinan-6-amine |
|---|---|
| PubChem CID | 174466968 |
| Molecular Formula | C6H15NO3Si |
| Molecular Weight | 177.28 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2,2-dimethoxyoxasilinan-6-amine |
| SMILES | CO[Si]1(OC)CCCC(N)O1 |
| InChI | InChI=1S/C6H15NO3Si/c1-8-11(9-2)5-3-4-6(7)10-11/h6H,3-5,7H2,1-2H3 |
| InChIKey | QSVIPQIWNNXGAK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|