C13H29NO3Si — CID 174818677
3-(3-ethyl-1,1,2-trimethoxysilinan-2-yl)propan-1-amine (PubChem CID 174818677) has the molecular formula C13H29NO3Si and a molecular weight of 275.46 g/mol. Its IUPAC name is 3-(3-ethyl-1,1,2-trimethoxysilinan-2-yl)propan-1-amine.
| Compound Name | 3-(3-ethyl-1,1,2-trimethoxysilinan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 174818677 |
| Molecular Formula | C13H29NO3Si |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-(3-ethyl-1,1,2-trimethoxysilinan-2-yl)propan-1-amine |
| SMILES | CCC1CCC[Si](OC)(OC)C1(CCCN)OC |
| InChI | InChI=1S/C13H29NO3Si/c1-5-12-8-6-11-18(16-3,17-4)13(12,15-2)9-7-10-14/h12H,5-11,14H2,1-4H3 |
| InChIKey | ZKRXOEWCAUWWFR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|