C15H27NO3Si — CID 174594008
1-(1,1,2-trimethoxy-2-propylsilinan-3-yl)pyrrole (PubChem CID 174594008) has the molecular formula C15H27NO3Si and a molecular weight of 297.47 g/mol. Its IUPAC name is 1-(1,1,2-trimethoxy-2-propylsilinan-3-yl)pyrrole.
| Compound Name | 1-(1,1,2-trimethoxy-2-propylsilinan-3-yl)pyrrole |
|---|---|
| PubChem CID | 174594008 |
| Molecular Formula | C15H27NO3Si |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-(1,1,2-trimethoxy-2-propylsilinan-3-yl)pyrrole |
| SMILES | CCCC1(OC)C(n2cccc2)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C15H27NO3Si/c1-5-10-15(17-2)14(16-11-6-7-12-16)9-8-13-20(15,18-3)19-4/h6-7,11-12,14H,5,8-10,13H2,1-4H3 |
| InChIKey | ABDMKTSZXFNSIP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|