C15H28O5Si — CID 174267912
(1,1,2-trimethoxy-2-propylsilinan-3-yl) but-2-enoate (PubChem CID 174267912) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is (1,1,2-trimethoxy-2-propylsilinan-3-yl) but-2-enoate.
| Compound Name | (1,1,2-trimethoxy-2-propylsilinan-3-yl) but-2-enoate |
|---|---|
| PubChem CID | 174267912 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1,1,2-trimethoxy-2-propylsilinan-3-yl) but-2-enoate |
| SMILES | CC=CC(=O)OC1CCC[Si](OC)(OC)C1(CCC)OC |
| InChI | InChI=1S/C15H28O5Si/c1-6-9-14(16)20-13-10-8-12-21(18-4,19-5)15(13,17-3)11-7-2/h6,9,13H,7-8,10-12H2,1-5H3 |
| InChIKey | RTBKIYLJQZHDHD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|