C27H57NO3Si — CID 174751630
1,1,2-trimethoxy-N,N-dioctyl-2-propylsilinan-3-amine (PubChem CID 174751630) has the molecular formula C27H57NO3Si and a molecular weight of 471.84 g/mol. Its IUPAC name is 1,1,2-trimethoxy-N,N-dioctyl-2-propylsilinan-3-amine.
| Compound Name | 1,1,2-trimethoxy-N,N-dioctyl-2-propylsilinan-3-amine |
|---|---|
| PubChem CID | 174751630 |
| Molecular Formula | C27H57NO3Si |
| Molecular Weight | 471.84 g/mol |
| Exact Mass | 471.41 |
| IUPAC Name | 1,1,2-trimethoxy-N,N-dioctyl-2-propylsilinan-3-amine |
| SMILES | CCCCCCCCN(CCCCCCCC)C1CCC[Si](OC)(OC)C1(CCC)OC |
| InChI | InChI=1S/C27H57NO3Si/c1-7-10-12-14-16-18-23-28(24-19-17-15-13-11-8-2)26-21-20-25-32(30-5,31-6)27(26,29-4)22-9-3/h26H,7-25H2,1-6H3 |
| InChIKey | LOOGCFCZLXKLFO-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.84 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|