C15H32O4Si — CID 174791973
1,1,2-trimethoxy-3-[(2-methylpropan-2-yl)oxy]-2-propylsilinane (PubChem CID 174791973) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is 1,1,2-trimethoxy-3-[(2-methylpropan-2-yl)oxy]-2-propylsilinane.
| Compound Name | 1,1,2-trimethoxy-3-[(2-methylpropan-2-yl)oxy]-2-propylsilinane |
|---|---|
| PubChem CID | 174791973 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 1,1,2-trimethoxy-3-[(2-methylpropan-2-yl)oxy]-2-propylsilinane |
| SMILES | CCCC1(OC)C(OC(C)(C)C)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C15H32O4Si/c1-8-11-15(16-5)13(19-14(2,3)4)10-9-12-20(15,17-6)18-7/h13H,8-12H2,1-7H3 |
| InChIKey | GSCWMLXNNBSTMA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|