About 3-chloro-1,1,2-trimethoxy-2-propylsilinane
3-chloro-1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174351373) has the molecular formula C11H23ClO3Si
and a molecular weight of 266.84 g/mol. Its IUPAC name is 3-chloro-1,1,2-trimethoxy-2-propylsilinane.
Molecular Properties
| Compound Name | 3-chloro-1,1,2-trimethoxy-2-propylsilinane |
| PubChem CID | 174351373 |
| Molecular Formula | C11H23ClO3Si |
| Molecular Weight | 266.84 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-chloro-1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CCCC1(OC)C(Cl)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C11H23ClO3Si/c1-5-8-11(13-2)10(12)7-6-9-16(11,14-3)15-4/h10H,5-9H2,1-4H3 |
| InChIKey | RAOHJUNEOFSADD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1,1,2-trimethoxy-2-propylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,1,2-trimethoxy-2-propylsilinane?
The IUPAC name of 3-chloro-1,1,2-trimethoxy-2-propylsilinane (CID 174351373) is 3-chloro-1,1,2-trimethoxy-2-propylsilinane.
What is the SMILES notation for 3-chloro-1,1,2-trimethoxy-2-propylsilinane?
The canonical SMILES for 3-chloro-1,1,2-trimethoxy-2-propylsilinane is CCCC1(OC)C(Cl)CCC[Si]1(OC)OC.
What is the InChIKey of 3-chloro-1,1,2-trimethoxy-2-propylsilinane?
The InChIKey is RAOHJUNEOFSADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23ClO3Si/c1-5-8-11(13-2)10(12)7-6-9-16(11,14-3)15-4/h10H,5-9H2,1-4H3.
What are the key properties of 3-chloro-1,1,2-trimethoxy-2-propylsilinane?
3-chloro-1,1,2-trimethoxy-2-propylsilinane has a molecular weight of 266.84 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,1,2-trimethoxy-2-propylsilinane is sourced from PubChem (CID 174351373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).