C11H23FO3Si — CID 174485939
3-fluoro-1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174485939) has the molecular formula C11H23FO3Si and a molecular weight of 250.39 g/mol. Its IUPAC name is 3-fluoro-1,1,2-trimethoxy-2-propylsilinane.
| Compound Name | 3-fluoro-1,1,2-trimethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 174485939 |
| Molecular Formula | C11H23FO3Si |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-fluoro-1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CCCC1(OC)C(F)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C11H23FO3Si/c1-5-8-11(13-2)10(12)7-6-9-16(11,14-3)15-4/h10H,5-9H2,1-4H3 |
| InChIKey | ZIYWJGMOWNNMMW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|