C18H36O6Si — CID 174779788
3-ethyl-3-[(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxymethoxymethyl]oxetane (PubChem CID 174779788) has the molecular formula C18H36O6Si and a molecular weight of 376.57 g/mol. Its IUPAC name is 3-ethyl-3-[(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxymethoxymethyl]oxetane.
| Compound Name | 3-ethyl-3-[(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxymethoxymethyl]oxetane |
|---|---|
| PubChem CID | 174779788 |
| Molecular Formula | C18H36O6Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 3-ethyl-3-[(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxymethoxymethyl]oxetane |
| SMILES | CCCC1(OC)C(OCOCC2(CC)COC2)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C18H36O6Si/c1-6-10-18(19-3)16(9-8-11-25(18,20-4)21-5)24-15-23-14-17(7-2)12-22-13-17/h16H,6-15H2,1-5H3 |
| InChIKey | CZOJYGLKOBAOKK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|