C17H34O3 — CID 160915976
3-(butoxymethyl)-3-ethyloxetane;3,3-diethyloxetane (PubChem CID 160915976) has the molecular formula C17H34O3 and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-(butoxymethyl)-3-ethyloxetane;3,3-diethyloxetane.
| Compound Name | 3-(butoxymethyl)-3-ethyloxetane;3,3-diethyloxetane |
|---|---|
| PubChem CID | 160915976 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 3-(butoxymethyl)-3-ethyloxetane;3,3-diethyloxetane |
| SMILES | CCC1(CC)COC1.CCCCOCC1(CC)COC1 |
| InChI | InChI=1S/C10H20O2.C7H14O/c1-3-5-6-11-7-10(4-2)8-12-9-10;1-3-7(4-2)5-8-6-7/h3-9H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | SRKFUOHDNAHATQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|