C26H48O6 — CID 59940311
3-[4,4-bis[(3-ethyloxetan-3-yl)methoxymethyl]hexoxymethyl]-3-ethyloxetane (PubChem CID 59940311) has the molecular formula C26H48O6 and a molecular weight of 456.66 g/mol. Its IUPAC name is 3-[4,4-bis[(3-ethyloxetan-3-yl)methoxymethyl]hexoxymethyl]-3-ethyloxetane.
| Compound Name | 3-[4,4-bis[(3-ethyloxetan-3-yl)methoxymethyl]hexoxymethyl]-3-ethyloxetane |
|---|---|
| PubChem CID | 59940311 |
| Molecular Formula | C26H48O6 |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | 3-[4,4-bis[(3-ethyloxetan-3-yl)methoxymethyl]hexoxymethyl]-3-ethyloxetane |
| SMILES | CCC(CCCOCC1(CC)COC1)(COCC1(CC)COC1)COCC1(CC)COC1 |
| InChI | InChI=1S/C26H48O6/c1-5-23(12-28-17-25(7-3)19-31-20-25,13-29-18-26(8-4)21-32-22-26)10-9-11-27-14-24(6-2)15-30-16-24/h5-22H2,1-4H3 |
| InChIKey | FWGWKLIEPIILRS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|