C16H34O5Si — CID 174747798
3-methyloxetane;1,1,2,3-tetramethoxy-2-propylsilinane (PubChem CID 174747798) has the molecular formula C16H34O5Si and a molecular weight of 334.53 g/mol. Its IUPAC name is 3-methyloxetane;1,1,2,3-tetramethoxy-2-propylsilinane.
| Compound Name | 3-methyloxetane;1,1,2,3-tetramethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 174747798 |
| Molecular Formula | C16H34O5Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 3-methyloxetane;1,1,2,3-tetramethoxy-2-propylsilinane |
| SMILES | CC1COC1.CCCC1(OC)C(OC)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C12H26O4Si.C4H8O/c1-6-9-12(14-3)11(13-2)8-7-10-17(12,15-4)16-5;1-4-2-5-3-4/h11H,6-10H2,1-5H3;4H,2-3H2,1H3 |
| InChIKey | VMBCEQVNZIYBGD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|