C14H26O5Si — CID 174793020
1,1,2-trimethoxy-3-(oxiran-2-ylmethyl)-2-propylsilinan-4-one (PubChem CID 174793020) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is 1,1,2-trimethoxy-3-(oxiran-2-ylmethyl)-2-propylsilinan-4-one.
| Compound Name | 1,1,2-trimethoxy-3-(oxiran-2-ylmethyl)-2-propylsilinan-4-one |
|---|---|
| PubChem CID | 174793020 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1,1,2-trimethoxy-3-(oxiran-2-ylmethyl)-2-propylsilinan-4-one |
| SMILES | CCCC1(OC)C(CC2CO2)C(=O)CC[Si]1(OC)OC |
| InChI | InChI=1S/C14H26O5Si/c1-5-7-14(16-2)12(9-11-10-19-11)13(15)6-8-20(14,17-3)18-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | CDLVYMYTWULZMX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|