C11H22O4SSi — CID 174559692
1,1,2-trimethoxy-2-propyl-3-sulfinylsilinane (PubChem CID 174559692) has the molecular formula C11H22O4SSi and a molecular weight of 278.45 g/mol. Its IUPAC name is 1,1,2-trimethoxy-2-propyl-3-sulfinylsilinane.
| Compound Name | 1,1,2-trimethoxy-2-propyl-3-sulfinylsilinane |
|---|---|
| PubChem CID | 174559692 |
| Molecular Formula | C11H22O4SSi |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1,1,2-trimethoxy-2-propyl-3-sulfinylsilinane |
| SMILES | CCCC1(OC)C(=S=O)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C11H22O4SSi/c1-5-8-11(13-2)10(16-12)7-6-9-17(11,14-3)15-4/h5-9H2,1-4H3 |
| InChIKey | FCIPGMAFZSYWTB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|