C28H55NO10Si2 — CID 174799613
3-[2-(3-aminopropyl)-1,1,2-trimethoxysilinan-3-yl]propyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 174799613) has the molecular formula C28H55NO10Si2 and a molecular weight of 621.92 g/mol. Its IUPAC name is 3-[2-(3-aminopropyl)-1,1,2-trimethoxysilinan-3-yl]propyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-(3-aminopropyl)-1,1,2-trimethoxysilinan-3-yl]propyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174799613 |
| Molecular Formula | C28H55NO10Si2 |
| Molecular Weight | 621.92 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | 3-[2-(3-aminopropyl)-1,1,2-trimethoxysilinan-3-yl]propyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC1CCC[Si](OC)(OC)C1(CCCN)OC.C=C(C)C(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C18H35NO5Si.C10H20O5Si/c1-15(2)17(20)24-13-6-9-16-10-7-14-25(22-4,23-5)18(16,21-3)11-8-12-19;1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5/h16H,1,6-14,19H2,2-5H3;1,6-8H2,2-5H3 |
| InChIKey | HKTKOSJECVAZJQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.92 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|