C24H50O8Si2 — CID 174978030
1-[dimethoxy(methyl)silyl]propan-1-ol;1-(1,1,2-trimethoxy-2-propylsilinan-3-yl)propyl 2-methylprop-2-enoate (PubChem CID 174978030) has the molecular formula C24H50O8Si2 and a molecular weight of 522.83 g/mol. Its IUPAC name is 1-[dimethoxy(methyl)silyl]propan-1-ol;1-(1,1,2-trimethoxy-2-propylsilinan-3-yl)propyl 2-methylprop-2-enoate.
| Compound Name | 1-[dimethoxy(methyl)silyl]propan-1-ol;1-(1,1,2-trimethoxy-2-propylsilinan-3-yl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174978030 |
| Molecular Formula | C24H50O8Si2 |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 1-[dimethoxy(methyl)silyl]propan-1-ol;1-(1,1,2-trimethoxy-2-propylsilinan-3-yl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)C1CCC[Si](OC)(OC)C1(CCC)OC.CCC(O)[Si](C)(OC)OC |
| InChI | InChI=1S/C18H34O5Si.C6H16O3Si/c1-8-12-18(20-5)15(11-10-13-24(18,21-6)22-7)16(9-2)23-17(19)14(3)4;1-5-6(7)10(4,8-2)9-3/h15-16H,3,8-13H2,1-2,4-7H3;6-7H,5H2,1-4H3 |
| InChIKey | MYPZCDNJUIHFSM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|