C13H20O3 — CID 139845851
(3-propyl-7-oxabicyclo[4.1.0]heptan-3-yl) 2-methylprop-2-enoate (PubChem CID 139845851) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3-propyl-7-oxabicyclo[4.1.0]heptan-3-yl) 2-methylprop-2-enoate.
| Compound Name | (3-propyl-7-oxabicyclo[4.1.0]heptan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139845851 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3-propyl-7-oxabicyclo[4.1.0]heptan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CCC)CCC2OC2C1 |
| InChI | InChI=1S/C13H20O3/c1-4-6-13(16-12(14)9(2)3)7-5-10-11(8-13)15-10/h10-11H,2,4-8H2,1,3H3 |
| InChIKey | PDBRBGQDJKDUGG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|