C15H26O3 — CID 138600745
(1,3-diethyl-3-hydroxy-5-methylcyclohexyl) 2-methylprop-2-enoate (PubChem CID 138600745) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1,3-diethyl-3-hydroxy-5-methylcyclohexyl) 2-methylprop-2-enoate.
| Compound Name | (1,3-diethyl-3-hydroxy-5-methylcyclohexyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138600745 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1,3-diethyl-3-hydroxy-5-methylcyclohexyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CC)CC(C)CC(O)(CC)C1 |
| InChI | InChI=1S/C15H26O3/c1-6-14(17)8-12(5)9-15(7-2,10-14)18-13(16)11(3)4/h12,17H,3,6-10H2,1-2,4-5H3 |
| InChIKey | NUGZVJYZFOQWLS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|