C12H16O4 — CID 57098433
4-(1-propylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid (PubChem CID 57098433) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-(1-propylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid.
| Compound Name | 4-(1-propylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 57098433 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-(1-propylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid |
| SMILES | C=C(C=CC(=O)O)C(=O)OC1(CCC)CC1 |
| InChI | InChI=1S/C12H16O4/c1-3-6-12(7-8-12)16-11(15)9(2)4-5-10(13)14/h4-5H,2-3,6-8H2,1H3,(H,13,14) |
| InChIKey | SKIFWBVLCPJTJO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|