C16H24O5 — CID 87085924
oxiran-2-ylmethyl 2-methylprop-2-enoate;(1-propylcyclopropyl) prop-2-enoate (PubChem CID 87085924) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-methylprop-2-enoate;(1-propylcyclopropyl) prop-2-enoate.
| Compound Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;(1-propylcyclopropyl) prop-2-enoate |
|---|---|
| PubChem CID | 87085924 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;(1-propylcyclopropyl) prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=CC(=O)OC1(CCC)CC1 |
| InChI | InChI=1S/C9H14O2.C7H10O3/c1-3-5-9(6-7-9)11-8(10)4-2;1-5(2)7(8)10-4-6-3-9-6/h4H,2-3,5-7H2,1H3;6H,1,3-4H2,2H3 |
| InChIKey | SFWOCHIWIQFNLP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|