C14H20O5 — CID 88834562
ethyl 2-methylprop-2-enoate;[1-(oxiran-2-yl)cyclopropyl] prop-2-enoate (PubChem CID 88834562) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate;[1-(oxiran-2-yl)cyclopropyl] prop-2-enoate.
| Compound Name | ethyl 2-methylprop-2-enoate;[1-(oxiran-2-yl)cyclopropyl] prop-2-enoate |
|---|---|
| PubChem CID | 88834562 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | ethyl 2-methylprop-2-enoate;[1-(oxiran-2-yl)cyclopropyl] prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC.C=CC(=O)OC1(C2CO2)CC1 |
| InChI | InChI=1S/C8H10O3.C6H10O2/c1-2-7(9)11-8(3-4-8)6-5-10-6;1-4-8-6(7)5(2)3/h2,6H,1,3-5H2;2,4H2,1,3H3 |
| InChIKey | KPPHXPLMFVWHTE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|