C20H32O5 — CID 87131206
(1-heptan-3-ylcyclopropyl) 2-methylprop-2-enoate;oxiran-2-ylmethyl prop-2-enoate (PubChem CID 87131206) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1-heptan-3-ylcyclopropyl) 2-methylprop-2-enoate;oxiran-2-ylmethyl prop-2-enoate.
| Compound Name | (1-heptan-3-ylcyclopropyl) 2-methylprop-2-enoate;oxiran-2-ylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 87131206 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1-heptan-3-ylcyclopropyl) 2-methylprop-2-enoate;oxiran-2-ylmethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C(CC)CCCC)CC1.C=CC(=O)OCC1CO1 |
| InChI | InChI=1S/C14H24O2.C6H8O3/c1-5-7-8-12(6-2)14(9-10-14)16-13(15)11(3)4;1-2-6(7)9-4-5-3-8-5/h12H,3,5-10H2,1-2,4H3;2,5H,1,3-4H2 |
| InChIKey | IZWJHEYJRATXDM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|