C16H27NO5 — CID 174820807
1-(diethylamino)ethyl 2-methylprop-2-enoate;oxiran-2-ylmethyl prop-2-enoate (PubChem CID 174820807) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-(diethylamino)ethyl 2-methylprop-2-enoate;oxiran-2-ylmethyl prop-2-enoate.
| Compound Name | 1-(diethylamino)ethyl 2-methylprop-2-enoate;oxiran-2-ylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 174820807 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-(diethylamino)ethyl 2-methylprop-2-enoate;oxiran-2-ylmethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)N(CC)CC.C=CC(=O)OCC1CO1 |
| InChI | InChI=1S/C10H19NO2.C6H8O3/c1-6-11(7-2)9(5)13-10(12)8(3)4;1-2-6(7)9-4-5-3-8-5/h9H,3,6-7H2,1-2,4-5H3;2,5H,1,3-4H2 |
| InChIKey | XRBABQBGUDVJRG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|