4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid

C16H24O4 — CID 87600976

IUPAC4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid
SMILESC=C(C=CC(=O)O)C(=O)OC1(C(CC)CCCC)CC1
InChIInChI=1S/C16H24O4/c1-4-6-7-13(5-2)16(10-11-16)20-15(19)12(3)8-9-14(17)18/h8-9,13H,3-7,10-11H2,1-2H3,(H,17,18)
InChIKeyAHMTXNQECPUVBF-UHFFFAOYSA-N
MW280.36 g/mol
LogP3.48
Rot. Bonds9

About 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid

4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid (PubChem CID 87600976) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid.

Molecular Properties

Compound Name4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid
PubChem CID87600976
Molecular FormulaC16H24O4
Molecular Weight280.36 g/mol
Exact Mass280.17
IUPAC Name4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid
SMILESC=C(C=CC(=O)O)C(=O)OC1(C(CC)CCCC)CC1
InChIInChI=1S/C16H24O4/c1-4-6-7-13(5-2)16(10-11-16)20-15(19)12(3)8-9-14(17)18/h8-9,13H,3-7,10-11H2,1-2H3,(H,17,18)
InChIKeyAHMTXNQECPUVBF-UHFFFAOYSA-N
XLogP3.48
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.36
LogP ≤ 53.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid?
The IUPAC name of 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid (CID 87600976) is 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid.
What is the SMILES notation for 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid?
The canonical SMILES for 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid is C=C(C=CC(=O)O)C(=O)OC1(C(CC)CCCC)CC1.
What is the InChIKey of 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid?
The InChIKey is AHMTXNQECPUVBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O4/c1-4-6-7-13(5-2)16(10-11-16)20-15(19)12(3)8-9-14(17)18/h8-9,13H,3-7,10-11H2,1-2H3,(H,17,18).
What are the key properties of 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid?
4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid has a molecular weight of 280.36 g/mol, XLogP of 3.48, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid is sourced from PubChem (CID 87600976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).