C16H24O4 — CID 87600976
4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid (PubChem CID 87600976) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid.
| Compound Name | 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87600976 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-(1-heptan-3-ylcyclopropyl)oxycarbonylpenta-2,4-dienoic acid |
| SMILES | C=C(C=CC(=O)O)C(=O)OC1(C(CC)CCCC)CC1 |
| InChI | InChI=1S/C16H24O4/c1-4-6-7-13(5-2)16(10-11-16)20-15(19)12(3)8-9-14(17)18/h8-9,13H,3-7,10-11H2,1-2H3,(H,17,18) |
| InChIKey | AHMTXNQECPUVBF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|