C13H24O3Si — CID 70402716
1-(2,6-dimethyloxasilinan-2-yl)propyl 2-methylprop-2-enoate (PubChem CID 70402716) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is 1-(2,6-dimethyloxasilinan-2-yl)propyl 2-methylprop-2-enoate.
| Compound Name | 1-(2,6-dimethyloxasilinan-2-yl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70402716 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-(2,6-dimethyloxasilinan-2-yl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)[Si]1(C)CCCC(C)O1 |
| InChI | InChI=1S/C13H24O3Si/c1-6-12(15-13(14)10(2)3)17(5)9-7-8-11(4)16-17/h11-12H,2,6-9H2,1,3-5H3 |
| InChIKey | YUBHSVRJUYQGFJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|