C9H16O5 — CID 90993225
1,2,5-trihydroxypentan-3-yl 2-methylprop-2-enoate (PubChem CID 90993225) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is 1,2,5-trihydroxypentan-3-yl 2-methylprop-2-enoate.
| Compound Name | 1,2,5-trihydroxypentan-3-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90993225 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1,2,5-trihydroxypentan-3-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCO)C(O)CO |
| InChI | InChI=1S/C9H16O5/c1-6(2)9(13)14-8(3-4-10)7(12)5-11/h7-8,10-12H,1,3-5H2,2H3 |
| InChIKey | SMKWNEFHXXZOJZ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|