C35H70O26 — CID 172709586
tetrakis((2S,3R)-butane-1,2,3,4-tetrol);[(2S,3R)-1,4-dihydroxy-3-(oxiran-2-ylmethoxy)butan-2-yl] 2-methylprop-2-enoate;bis(2-methylprop-2-enoic acid) (PubChem CID 172709586) has the molecular formula C35H70O26 and a molecular weight of 906.92 g/mol. Its IUPAC name is tetrakis((2S,3R)-butane-1,2,3,4-tetrol);[(2S,3R)-1,4-dihydroxy-3-(oxiran-2-ylmethoxy)butan-2-yl] 2-methylprop-2-enoate;bis(2-methylprop-2-enoic acid).
| Compound Name | tetrakis((2S,3R)-butane-1,2,3,4-tetrol);[(2S,3R)-1,4-dihydroxy-3-(oxiran-2-ylmethoxy)butan-2-yl] 2-methylprop-2-enoate;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 172709586 |
| Molecular Formula | C35H70O26 |
| Molecular Weight | 906.92 g/mol |
| Exact Mass | 906.42 |
| IUPAC Name | tetrakis((2S,3R)-butane-1,2,3,4-tetrol);[(2S,3R)-1,4-dihydroxy-3-(oxiran-2-ylmethoxy)butan-2-yl] 2-methylprop-2-enoate;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)O[C@@H](CO)[C@@H](CO)OCC1CO1.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C11H18O6.4C4H10O4.2C4H6O2/c1-7(2)11(14)17-10(4-13)9(3-12)16-6-8-5-15-8;4*5-1-3(7)4(8)2-6;2*1-3(2)4(5)6/h8-10,12-13H,1,3-6H2,2H3;4*3-8H,1-2H2;2*1H2,2H3,(H,5,6)/t8?,9-,10+;4*3-,4+;;/m1....../s1 |
| InChIKey | FBHJXEGVXSWXSF-WKEBWPGBSA-N |
| XLogP | -8.69 |
| TPSA | 486.80 Ų |
| H-Bond Donors | 20 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.92 |
| LogP ≤ 5 | -8.69 |
| H-Bond Donors ≤ 5 | 20 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|