C17H28O6 — CID 91584532
[(2S,3R)-3,4-dihydroxy-2-(2-methylprop-2-enoyloxy)butyl] 2-methyloct-2-enoate (PubChem CID 91584532) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(2S,3R)-3,4-dihydroxy-2-(2-methylprop-2-enoyloxy)butyl] 2-methyloct-2-enoate.
| Compound Name | [(2S,3R)-3,4-dihydroxy-2-(2-methylprop-2-enoyloxy)butyl] 2-methyloct-2-enoate |
|---|---|
| PubChem CID | 91584532 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(2S,3R)-3,4-dihydroxy-2-(2-methylprop-2-enoyloxy)butyl] 2-methyloct-2-enoate |
| SMILES | C=C(C)C(=O)O[C@@H](COC(=O)C(C)=CCCCCC)[C@H](O)CO |
| InChI | InChI=1S/C17H28O6/c1-5-6-7-8-9-13(4)17(21)22-11-15(14(19)10-18)23-16(20)12(2)3/h9,14-15,18-19H,2,5-8,10-11H2,1,3-4H3/t14-,15+/m1/s1 |
| InChIKey | ULFCDRSGSORIMP-CABCVRRESA-N |
| XLogP | 1.90 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|