C22H32O8 — CID 139823116
bis[1-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate (PubChem CID 139823116) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is bis[1-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate.
| Compound Name | bis[1-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139823116 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | bis[1-(2-methylprop-2-enoyloxy)propyl] cyclohexane-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OC(CC)OC(=O)C1CCCCC1C(=O)OC(CC)OC(=O)C(=C)C |
| InChI | InChI=1S/C22H32O8/c1-7-17(27-19(23)13(3)4)29-21(25)15-11-9-10-12-16(15)22(26)30-18(8-2)28-20(24)14(5)6/h15-18H,3,5,7-12H2,1-2,4,6H3 |
| InChIKey | BICZMHKSJVKJFG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|