About 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate
2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate (PubChem CID 160929213) has the molecular formula C16H28O5
and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate |
| PubChem CID | 160929213 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate |
| SMILES | C=C(C)C.CCCOC(=O)C1CCCCC1C(=O)OOC |
| InChI | InChI=1S/C12H20O5.C4H8/c1-3-8-16-11(13)9-6-4-5-7-10(9)12(14)17-15-2;1-4(2)3/h9-10H,3-8H2,1-2H3;1H2,2-3H3 |
| InChIKey | STARDRGXTMKKNI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate?
The IUPAC name of 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate (CID 160929213) is 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate.
What is the SMILES notation for 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate?
The canonical SMILES for 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate is C=C(C)C.CCCOC(=O)C1CCCCC1C(=O)OOC.
What is the InChIKey of 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate?
The InChIKey is STARDRGXTMKKNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5.C4H8/c1-3-8-16-11(13)9-6-4-5-7-10(9)12(14)17-15-2;1-4(2)3/h9-10H,3-8H2,1-2H3;1H2,2-3H3.
What are the key properties of 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate?
2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate has a molecular weight of 300.40 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate is sourced from PubChem (CID 160929213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).